C29H41N7O4 — CID 123391041
butyl 2-[[2-[3-(3-amino-2-methanimidoylphenyl)propylamino]-4,6-dimethylpyrimidine-5-carbonyl]amino]-3-(2-methylbut-2-enoylamino)propanoate (PubChem CID 123391041) has the molecular formula C29H41N7O4 and a molecular weight of 551.69 g/mol. Its IUPAC name is butyl 2-[[2-[3-(3-amino-2-methanimidoylphenyl)propylamino]-4,6-dimethylpyrimidine-5-carbonyl]amino]-3-(2-methylbut-2-enoylamino)propanoate.
| Compound Name | butyl 2-[[2-[3-(3-amino-2-methanimidoylphenyl)propylamino]-4,6-dimethylpyrimidine-5-carbonyl]amino]-3-(2-methylbut-2-enoylamino)propanoate |
|---|---|
| PubChem CID | 123391041 |
| Molecular Formula | C29H41N7O4 |
| Molecular Weight | 551.69 g/mol |
| Exact Mass | 551.32 |
| IUPAC Name | butyl 2-[[2-[3-(3-amino-2-methanimidoylphenyl)propylamino]-4,6-dimethylpyrimidine-5-carbonyl]amino]-3-(2-methylbut-2-enoylamino)propanoate |
| SMILES | [H]/N=C/c1c(N)cccc1CCCNc1nc(C)c(C(=O)NC(CNC(=O)C(C)=CC)C(=O)OCCCC)c(C)n1 |
| InChI | InChI=1S/C29H41N7O4/c1-6-8-15-40-28(39)24(17-33-26(37)18(3)7-2)36-27(38)25-19(4)34-29(35-20(25)5)32-14-10-12-21-11-9-13-23(31)22(21)16-30/h7,9,11,13,16,24,30H,6,8,10,12,14-15,17,31H2,1-5H3,(H,33,37)(H,36,38)(H,32,34,35)/b18-7?,30-16+ |
| InChIKey | QFUSSOUQKIHDRY-OCUWVJLVSA-N |
| XLogP | 3.24 |
| TPSA | 172.18 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.69 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|