C20H41N3Si — CID 123392075
1-N,1-N',1-N"-tricyclohexyl-2-silylethane-1,1,1-triamine (PubChem CID 123392075) has the molecular formula C20H41N3Si and a molecular weight of 351.66 g/mol. Its IUPAC name is 1-N,1-N',1-N"-tricyclohexyl-2-silylethane-1,1,1-triamine.
| Compound Name | 1-N,1-N',1-N"-tricyclohexyl-2-silylethane-1,1,1-triamine |
|---|---|
| PubChem CID | 123392075 |
| Molecular Formula | C20H41N3Si |
| Molecular Weight | 351.66 g/mol |
| Exact Mass | 351.31 |
| IUPAC Name | 1-N,1-N',1-N"-tricyclohexyl-2-silylethane-1,1,1-triamine |
| SMILES | [SiH3]CC(NC1CCCCC1)(NC1CCCCC1)NC1CCCCC1 |
| InChI | InChI=1S/C20H41N3Si/c24-16-20(21-17-10-4-1-5-11-17,22-18-12-6-2-7-13-18)23-19-14-8-3-9-15-19/h17-19,21-23H,1-16H2,24H3 |
| InChIKey | RHXKEBZVRQMDRO-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 36.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.66 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|