C17H19BClN2O3 — CID 123392950
CID 123392950 (PubChem CID 123392950) has the molecular formula C17H19BClN2O3 and a molecular weight of 345.62 g/mol.
| Compound Name | CID 123392950 |
|---|---|
| PubChem CID | 123392950 |
| Molecular Formula | C17H19BClN2O3 |
| Molecular Weight | 345.62 g/mol |
| Exact Mass | 345.12 |
| IUPAC Name | — |
| SMILES | C=C(O[B]O)c1ccccc1.C=CCc1c(Cl)nc(C)nc1OC |
| InChI | InChI=1S/C9H11ClN2O.C8H8BO2/c1-4-5-7-8(10)11-6(2)12-9(7)13-3;1-7(11-9-10)8-5-3-2-4-6-8/h4H,1,5H2,2-3H3;2-6,10H,1H2 |
| InChIKey | LNQXOOHVQBATEK-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 64.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.62 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|