C29H47NO2 — CID 123393010
5a,5b,8,8,11a-pentamethyl-3a-nitroso-1-prop-1-en-2-yl-1,2,3,4,5,6,7,7a,9,10,11,11b,12,13,13a,13b-hexadecahydrocyclopenta[a]chrysen-9-ol (PubChem CID 123393010) has the molecular formula C29H47NO2 and a molecular weight of 441.70 g/mol. Its IUPAC name is 5a,5b,8,8,11a-pentamethyl-3a-nitroso-1-prop-1-en-2-yl-1,2,3,4,5,6,7,7a,9,10,11,11b,12,13,13a,13b-hexadecahydrocyclopenta[a]chrysen-9-ol.
| Compound Name | 5a,5b,8,8,11a-pentamethyl-3a-nitroso-1-prop-1-en-2-yl-1,2,3,4,5,6,7,7a,9,10,11,11b,12,13,13a,13b-hexadecahydrocyclopenta[a]chrysen-9-ol |
|---|---|
| PubChem CID | 123393010 |
| Molecular Formula | C29H47NO2 |
| Molecular Weight | 441.70 g/mol |
| Exact Mass | 441.36 |
| IUPAC Name | 5a,5b,8,8,11a-pentamethyl-3a-nitroso-1-prop-1-en-2-yl-1,2,3,4,5,6,7,7a,9,10,11,11b,12,13,13a,13b-hexadecahydrocyclopenta[a]chrysen-9-ol |
| SMILES | C=C(C)C1CCC2(N=O)CCC3(C)C(CCC4C5(C)CCC(O)C(C)(C)C5CCC43C)C12 |
| InChI | InChI=1S/C29H47NO2/c1-18(2)19-10-15-29(30-32)17-16-27(6)20(24(19)29)8-9-22-26(5)13-12-23(31)25(3,4)21(26)11-14-28(22,27)7/h19-24,31H,1,8-17H2,2-7H3 |
| InChIKey | JGLKZKFJJXZEEL-UHFFFAOYSA-N |
| XLogP | 7.52 |
| TPSA | 49.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.70 |
| LogP ≤ 5 | 7.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|