C27H40N4O3 — CID 123393849
1-[4-[2-[3-hydroxy-3-(methoxymethyl)cyclohexyl]ethyl]-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-1-yl]-2-(triazolo[4,5-c]pyridin-2-yl)ethanone (PubChem CID 123393849) has the molecular formula C27H40N4O3 and a molecular weight of 468.64 g/mol. Its IUPAC name is 1-[4-[2-[3-hydroxy-3-(methoxymethyl)cyclohexyl]ethyl]-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-1-yl]-2-(triazolo[4,5-c]pyridin-2-yl)ethanone.
| Compound Name | 1-[4-[2-[3-hydroxy-3-(methoxymethyl)cyclohexyl]ethyl]-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-1-yl]-2-(triazolo[4,5-c]pyridin-2-yl)ethanone |
|---|---|
| PubChem CID | 123393849 |
| Molecular Formula | C27H40N4O3 |
| Molecular Weight | 468.64 g/mol |
| Exact Mass | 468.31 |
| IUPAC Name | 1-[4-[2-[3-hydroxy-3-(methoxymethyl)cyclohexyl]ethyl]-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-1-yl]-2-(triazolo[4,5-c]pyridin-2-yl)ethanone |
| SMILES | COCC1(O)CCCC(CCC2CCCC3(C)C(C(=O)Cn4nc5ccncc5n4)CCC23)C1 |
| InChI | InChI=1S/C27H40N4O3/c1-26-12-4-6-20(8-7-19-5-3-13-27(33,15-19)18-34-2)21(26)9-10-22(26)25(32)17-31-29-23-11-14-28-16-24(23)30-31/h11,14,16,19-22,33H,3-10,12-13,15,17-18H2,1-2H3 |
| InChIKey | SITWKGWZDAGXFN-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 90.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.64 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |