C14H20N6O — CID 123393870
1-cyclopentyl-3-[3-(ethylamino)-1H-pyrazolo[4,3-c]pyridin-6-yl]urea (PubChem CID 123393870) has the molecular formula C14H20N6O and a molecular weight of 288.36 g/mol. Its IUPAC name is 1-cyclopentyl-3-[3-(ethylamino)-1H-pyrazolo[4,3-c]pyridin-6-yl]urea.
| Compound Name | 1-cyclopentyl-3-[3-(ethylamino)-1H-pyrazolo[4,3-c]pyridin-6-yl]urea |
|---|---|
| PubChem CID | 123393870 |
| Molecular Formula | C14H20N6O |
| Molecular Weight | 288.36 g/mol |
| Exact Mass | 288.17 |
| IUPAC Name | 1-cyclopentyl-3-[3-(ethylamino)-1H-pyrazolo[4,3-c]pyridin-6-yl]urea |
| SMILES | CCNc1n[nH]c2cc(NC(=O)NC3CCCC3)ncc12 |
| InChI | InChI=1S/C14H20N6O/c1-2-15-13-10-8-16-12(7-11(10)19-20-13)18-14(21)17-9-5-3-4-6-9/h7-9H,2-6H2,1H3,(H2,15,19,20)(H2,16,17,18,21) |
| InChIKey | QFHJVGIMALRDPK-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 94.73 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.36 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |