C12H18N6OS — CID 135293268
1-[3-(ethylamino)-1H-pyrazolo[4,3-c]pyridin-6-yl]-3-(2-methylsulfanylethyl)urea (PubChem CID 135293268) has the molecular formula C12H18N6OS and a molecular weight of 294.38 g/mol. Its IUPAC name is 1-[3-(ethylamino)-1H-pyrazolo[4,3-c]pyridin-6-yl]-3-(2-methylsulfanylethyl)urea.
| Compound Name | 1-[3-(ethylamino)-1H-pyrazolo[4,3-c]pyridin-6-yl]-3-(2-methylsulfanylethyl)urea |
|---|---|
| PubChem CID | 135293268 |
| Molecular Formula | C12H18N6OS |
| Molecular Weight | 294.38 g/mol |
| Exact Mass | 294.13 |
| IUPAC Name | 1-[3-(ethylamino)-1H-pyrazolo[4,3-c]pyridin-6-yl]-3-(2-methylsulfanylethyl)urea |
| SMILES | CCNc1n[nH]c2cc(NC(=O)NCCSC)ncc12 |
| InChI | InChI=1S/C12H18N6OS/c1-3-13-11-8-7-15-10(6-9(8)17-18-11)16-12(19)14-4-5-20-2/h6-7H,3-5H2,1-2H3,(H2,13,17,18)(H2,14,15,16,19) |
| InChIKey | XJZLIQOZJKMYKF-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 94.73 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.38 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|