C30H28F5N5O3 — CID 123394141
(2E,4E)-N-[[5-[5-(4,4-difluoropiperidine-1-carbonyl)-2-pyridinyl]-7-(trifluoromethyl)-1-benzofuran-2-yl]methyl]-7-imino-4-methyl-7-(methylideneamino)hepta-2,4-dienamide (PubChem CID 123394141) has the molecular formula C30H28F5N5O3 and a molecular weight of 601.58 g/mol. Its IUPAC name is (2E,4E)-N-[[5-[5-(4,4-difluoropiperidine-1-carbonyl)-2-pyridinyl]-7-(trifluoromethyl)-1-benzofuran-2-yl]methyl]-7-imino-4-methyl-7-(methylideneamino)hepta-2,4-dienamide.
| Compound Name | (2E,4E)-N-[[5-[5-(4,4-difluoropiperidine-1-carbonyl)-2-pyridinyl]-7-(trifluoromethyl)-1-benzofuran-2-yl]methyl]-7-imino-4-methyl-7-(methylideneamino)hepta-2,4-dienamide |
|---|---|
| PubChem CID | 123394141 |
| Molecular Formula | C30H28F5N5O3 |
| Molecular Weight | 601.58 g/mol |
| Exact Mass | 601.21 |
| IUPAC Name | (2E,4E)-N-[[5-[5-(4,4-difluoropiperidine-1-carbonyl)-2-pyridinyl]-7-(trifluoromethyl)-1-benzofuran-2-yl]methyl]-7-imino-4-methyl-7-(methylideneamino)hepta-2,4-dienamide |
| SMILES | [H]/N=C(/C/C=C(C)/C=C/C(=O)NCc1cc2cc(-c3ccc(C(=O)N4CCC(F)(F)CC4)cn3)cc(C(F)(F)F)c2o1)N=C |
| InChI | InChI=1S/C30H28F5N5O3/c1-18(3-7-25(36)37-2)4-8-26(41)39-17-22-14-21-13-20(15-23(27(21)43-22)30(33,34)35)24-6-5-19(16-38-24)28(42)40-11-9-29(31,32)10-12-40/h3-6,8,13-16,36H,2,7,9-12,17H2,1H3,(H,39,41)/b8-4+,18-3+,36-25- |
| InChIKey | UNPBKQDKLBXWNN-NKRAIQEXSA-N |
| XLogP | 6.57 |
| TPSA | 111.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.58 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|