C17H11F3N2O4 — CID 144770868
6-[2-(formamidomethyl)-7-(trifluoromethyl)-1-benzofuran-5-yl]pyridine-3-carboxylic acid (PubChem CID 144770868) has the molecular formula C17H11F3N2O4 and a molecular weight of 364.28 g/mol. Its IUPAC name is 6-[2-(formamidomethyl)-7-(trifluoromethyl)-1-benzofuran-5-yl]pyridine-3-carboxylic acid.
| Compound Name | 6-[2-(formamidomethyl)-7-(trifluoromethyl)-1-benzofuran-5-yl]pyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 144770868 |
| Molecular Formula | C17H11F3N2O4 |
| Molecular Weight | 364.28 g/mol |
| Exact Mass | 364.07 |
| IUPAC Name | 6-[2-(formamidomethyl)-7-(trifluoromethyl)-1-benzofuran-5-yl]pyridine-3-carboxylic acid |
| SMILES | O=CNCc1cc2cc(-c3ccc(C(=O)O)cn3)cc(C(F)(F)F)c2o1 |
| InChI | InChI=1S/C17H11F3N2O4/c18-17(19,20)13-5-10(14-2-1-9(6-22-14)16(24)25)3-11-4-12(7-21-8-23)26-15(11)13/h1-6,8H,7H2,(H,21,23)(H,24,25) |
| InChIKey | YBFFACGRAAFLOG-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 92.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.28 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|