C21H27FN4O4 — CID 123395449
20-fluoro-11,16-dimethyl-15-(methylideneamino)-2-oxa-8,11,16-triazatricyclo[16.4.0.04,8]docosa-1(18),19,21-triene-9,12,17-trione (PubChem CID 123395449) has the molecular formula C21H27FN4O4 and a molecular weight of 418.47 g/mol. Its IUPAC name is 20-fluoro-11,16-dimethyl-15-(methylideneamino)-2-oxa-8,11,16-triazatricyclo[16.4.0.04,8]docosa-1(18),19,21-triene-9,12,17-trione.
| Compound Name | 20-fluoro-11,16-dimethyl-15-(methylideneamino)-2-oxa-8,11,16-triazatricyclo[16.4.0.04,8]docosa-1(18),19,21-triene-9,12,17-trione |
|---|---|
| PubChem CID | 123395449 |
| Molecular Formula | C21H27FN4O4 |
| Molecular Weight | 418.47 g/mol |
| Exact Mass | 418.20 |
| IUPAC Name | 20-fluoro-11,16-dimethyl-15-(methylideneamino)-2-oxa-8,11,16-triazatricyclo[16.4.0.04,8]docosa-1(18),19,21-triene-9,12,17-trione |
| SMILES | C=NC1CCC(=O)N(C)CC(=O)N2CCCC2COc2ccc(F)cc2C(=O)N1C |
| InChI | InChI=1S/C21H27FN4O4/c1-23-18-8-9-19(27)24(2)12-20(28)26-10-4-5-15(26)13-30-17-7-6-14(22)11-16(17)21(29)25(18)3/h6-7,11,15,18H,1,4-5,8-10,12-13H2,2-3H3 |
| InChIKey | KIVUEJYAJAZDSP-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 82.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.47 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|