C25H30N4O4 — CID 140666829
(9S,16R)-16,17,20-trimethyl-7-oxa-13,17,20,24-tetrazatetracyclo[20.3.1.12,6.09,13]heptacosa-1(26),2(27),3,5,22,24-hexaene-14,18,21-trione (PubChem CID 140666829) has the molecular formula C25H30N4O4 and a molecular weight of 450.54 g/mol. Its IUPAC name is (9S,16R)-16,17,20-trimethyl-7-oxa-13,17,20,24-tetrazatetracyclo[20.3.1.12,6.09,13]heptacosa-1(26),2(27),3,5,22,24-hexaene-14,18,21-trione.
| Compound Name | (9S,16R)-16,17,20-trimethyl-7-oxa-13,17,20,24-tetrazatetracyclo[20.3.1.12,6.09,13]heptacosa-1(26),2(27),3,5,22,24-hexaene-14,18,21-trione |
|---|---|
| PubChem CID | 140666829 |
| Molecular Formula | C25H30N4O4 |
| Molecular Weight | 450.54 g/mol |
| Exact Mass | 450.23 |
| IUPAC Name | (9S,16R)-16,17,20-trimethyl-7-oxa-13,17,20,24-tetrazatetracyclo[20.3.1.12,6.09,13]heptacosa-1(26),2(27),3,5,22,24-hexaene-14,18,21-trione |
| SMILES | C[C@@H]1CC(=O)N2CCCC2COc2cccc(c2)-c2cncc(c2)C(=O)N(C)CC(=O)N1C |
| InChI | InChI=1S/C25H30N4O4/c1-17-10-23(30)29-9-5-7-21(29)16-33-22-8-4-6-18(12-22)19-11-20(14-26-13-19)25(32)27(2)15-24(31)28(17)3/h4,6,8,11-14,17,21H,5,7,9-10,15-16H2,1-3H3/t17-,21?/m1/s1 |
| InChIKey | RLLLPMQSCCTCGY-OQHSHRKDSA-N |
| XLogP | 2.44 |
| TPSA | 83.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.54 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |