C22H24N2O3 — CID 123157395
20-oxa-9,14-diazatetracyclo[19.3.1.02,7.014,18]pentacosa-1(25),2,4,6,21,23-hexaene-8,13-dione (PubChem CID 123157395) has the molecular formula C22H24N2O3 and a molecular weight of 364.44 g/mol. Its IUPAC name is 20-oxa-9,14-diazatetracyclo[19.3.1.02,7.014,18]pentacosa-1(25),2,4,6,21,23-hexaene-8,13-dione.
| Compound Name | 20-oxa-9,14-diazatetracyclo[19.3.1.02,7.014,18]pentacosa-1(25),2,4,6,21,23-hexaene-8,13-dione |
|---|---|
| PubChem CID | 123157395 |
| Molecular Formula | C22H24N2O3 |
| Molecular Weight | 364.44 g/mol |
| Exact Mass | 364.18 |
| IUPAC Name | 20-oxa-9,14-diazatetracyclo[19.3.1.02,7.014,18]pentacosa-1(25),2,4,6,21,23-hexaene-8,13-dione |
| SMILES | O=C1NCCCC(=O)N2CCCC2COc2cccc(c2)-c2ccccc21 |
| InChI | InChI=1S/C22H24N2O3/c25-21-11-4-12-23-22(26)20-10-2-1-9-19(20)16-6-3-8-18(14-16)27-15-17-7-5-13-24(17)21/h1-3,6,8-10,14,17H,4-5,7,11-13,15H2,(H,23,26) |
| InChIKey | CMLKPPOWVBDIIH-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.44 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |