C24H27N3O6S — CID 140666803
amino (12Z)-6,15-dioxo-10,22-dioxa-4-thia-7,16-diazatetracyclo[21.3.1.12,5.016,20]octacosa-1(27),2,5(28),12,23,25-hexaene-8-carboxylate (PubChem CID 140666803) has the molecular formula C24H27N3O6S and a molecular weight of 485.56 g/mol. Its IUPAC name is amino (12Z)-6,15-dioxo-10,22-dioxa-4-thia-7,16-diazatetracyclo[21.3.1.12,5.016,20]octacosa-1(27),2,5(28),12,23,25-hexaene-8-carboxylate.
| Compound Name | amino (12Z)-6,15-dioxo-10,22-dioxa-4-thia-7,16-diazatetracyclo[21.3.1.12,5.016,20]octacosa-1(27),2,5(28),12,23,25-hexaene-8-carboxylate |
|---|---|
| PubChem CID | 140666803 |
| Molecular Formula | C24H27N3O6S |
| Molecular Weight | 485.56 g/mol |
| Exact Mass | 485.16 |
| IUPAC Name | amino (12Z)-6,15-dioxo-10,22-dioxa-4-thia-7,16-diazatetracyclo[21.3.1.12,5.016,20]octacosa-1(27),2,5(28),12,23,25-hexaene-8-carboxylate |
| SMILES | NOC(=O)C1COC/C=C\CC(=O)N2CCCC2COc2cccc(c2)-c2csc(c2)C(=O)N1 |
| InChI | InChI=1S/C24H27N3O6S/c25-33-24(30)20-14-31-10-2-1-8-22(28)27-9-4-6-18(27)13-32-19-7-3-5-16(11-19)17-12-21(34-15-17)23(29)26-20/h1-3,5,7,11-12,15,18,20H,4,6,8-10,13-14,25H2,(H,26,29)/b2-1- |
| InChIKey | SZSCPJALDVYJBY-UPHRSURJSA-N |
| XLogP | 2.28 |
| TPSA | 120.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.56 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|