C40H38N2O8 — CID 102160781
11,20,35,40-tetraoxa-3,28-diazapentacyclo[39.3.1.130,34.04,9.022,27]hexatetraconta-1(45),4,6,8,15,22,24,26,30(46),31,33,37,41,43-tetradecaene-2,10,21,29-tetrone (PubChem CID 102160781) has the molecular formula C40H38N2O8 and a molecular weight of 674.75 g/mol. Its IUPAC name is 11,20,35,40-tetraoxa-3,28-diazapentacyclo[39.3.1.130,34.04,9.022,27]hexatetraconta-1(45),4,6,8,15,22,24,26,30(46),31,33,37,41,43-tetradecaene-2,10,21,29-tetrone.
| Compound Name | 11,20,35,40-tetraoxa-3,28-diazapentacyclo[39.3.1.130,34.04,9.022,27]hexatetraconta-1(45),4,6,8,15,22,24,26,30(46),31,33,37,41,43-tetradecaene-2,10,21,29-tetrone |
|---|---|
| PubChem CID | 102160781 |
| Molecular Formula | C40H38N2O8 |
| Molecular Weight | 674.75 g/mol |
| Exact Mass | 674.26 |
| IUPAC Name | 11,20,35,40-tetraoxa-3,28-diazapentacyclo[39.3.1.130,34.04,9.022,27]hexatetraconta-1(45),4,6,8,15,22,24,26,30(46),31,33,37,41,43-tetradecaene-2,10,21,29-tetrone |
| SMILES | O=C1Nc2ccccc2C(=O)OCCCC=CCCCOC(=O)c2ccccc2NC(=O)c2cccc(c2)OCC=CCOc2cccc1c2 |
| InChI | InChI=1S/C40H38N2O8/c43-37-29-15-13-17-31(27-29)47-23-11-12-24-48-32-18-14-16-30(28-32)38(44)42-36-22-8-6-20-34(36)40(46)50-26-10-4-2-1-3-9-25-49-39(45)33-19-5-7-21-35(33)41-37/h1-2,5-8,11-22,27-28H,3-4,9-10,23-26H2,(H,41,43)(H,42,44) |
| InChIKey | KNCLNHANSNMYIX-UHFFFAOYSA-N |
| XLogP | 7.65 |
| TPSA | 129.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 674.75 |
| LogP ≤ 5 | 7.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|