C19H20N2O4S — CID 167758086
2-[3-(2-oxopyrrolidin-1-yl)piperidine-1-carbonyl]-1-benzothiophene-4-carboxylic acid (PubChem CID 167758086) has the molecular formula C19H20N2O4S and a molecular weight of 372.45 g/mol. Its IUPAC name is 2-[3-(2-oxopyrrolidin-1-yl)piperidine-1-carbonyl]-1-benzothiophene-4-carboxylic acid.
| Compound Name | 2-[3-(2-oxopyrrolidin-1-yl)piperidine-1-carbonyl]-1-benzothiophene-4-carboxylic acid |
|---|---|
| PubChem CID | 167758086 |
| Molecular Formula | C19H20N2O4S |
| Molecular Weight | 372.45 g/mol |
| Exact Mass | 372.11 |
| IUPAC Name | 2-[3-(2-oxopyrrolidin-1-yl)piperidine-1-carbonyl]-1-benzothiophene-4-carboxylic acid |
| SMILES | O=C(O)c1cccc2sc(C(=O)N3CCCC(N4CCCC4=O)C3)cc12 |
| InChI | InChI=1S/C19H20N2O4S/c22-17-7-3-9-21(17)12-4-2-8-20(11-12)18(23)16-10-14-13(19(24)25)5-1-6-15(14)26-16/h1,5-6,10,12H,2-4,7-9,11H2,(H,24,25) |
| InChIKey | SRGWXYUEWDXZCP-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 77.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.45 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |