C18H22ClN3O4 — CID 97433884
methyl 2-chloro-5-[[(3R)-3-(2-oxopyrrolidin-1-yl)piperidine-1-carbonyl]amino]benzoate (PubChem CID 97433884) has the molecular formula C18H22ClN3O4 and a molecular weight of 379.84 g/mol. Its IUPAC name is methyl 2-chloro-5-[[(3R)-3-(2-oxopyrrolidin-1-yl)piperidine-1-carbonyl]amino]benzoate.
| Compound Name | methyl 2-chloro-5-[[(3R)-3-(2-oxopyrrolidin-1-yl)piperidine-1-carbonyl]amino]benzoate |
|---|---|
| PubChem CID | 97433884 |
| Molecular Formula | C18H22ClN3O4 |
| Molecular Weight | 379.84 g/mol |
| Exact Mass | 379.13 |
| IUPAC Name | methyl 2-chloro-5-[[(3R)-3-(2-oxopyrrolidin-1-yl)piperidine-1-carbonyl]amino]benzoate |
| SMILES | COC(=O)c1cc(NC(=O)N2CCC[C@@H](N3CCCC3=O)C2)ccc1Cl |
| InChI | InChI=1S/C18H22ClN3O4/c1-26-17(24)14-10-12(6-7-15(14)19)20-18(25)21-8-2-4-13(11-21)22-9-3-5-16(22)23/h6-7,10,13H,2-5,8-9,11H2,1H3,(H,20,25)/t13-/m1/s1 |
| InChIKey | FUNFPDGYIAMNNC-CYBMUJFWSA-N |
| XLogP | 2.75 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.84 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |