C20H26N2O2 — CID 98524916
1-[(3S)-1-[(E)-3-(2-methylphenyl)but-2-enoyl]piperidin-3-yl]pyrrolidin-2-one (PubChem CID 98524916) has the molecular formula C20H26N2O2 and a molecular weight of 326.44 g/mol. Its IUPAC name is 1-[(3S)-1-[(E)-3-(2-methylphenyl)but-2-enoyl]piperidin-3-yl]pyrrolidin-2-one.
| Compound Name | 1-[(3S)-1-[(E)-3-(2-methylphenyl)but-2-enoyl]piperidin-3-yl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 98524916 |
| Molecular Formula | C20H26N2O2 |
| Molecular Weight | 326.44 g/mol |
| Exact Mass | 326.20 |
| IUPAC Name | 1-[(3S)-1-[(E)-3-(2-methylphenyl)but-2-enoyl]piperidin-3-yl]pyrrolidin-2-one |
| SMILES | C/C(=C\C(=O)N1CCC[C@H](N2CCCC2=O)C1)c1ccccc1C |
| InChI | InChI=1S/C20H26N2O2/c1-15-7-3-4-9-18(15)16(2)13-20(24)21-11-5-8-17(14-21)22-12-6-10-19(22)23/h3-4,7,9,13,17H,5-6,8,10-12,14H2,1-2H3/b16-13+/t17-/m0/s1 |
| InChIKey | CZCLNWDVGRXJOM-MAUBAPBLSA-N |
| XLogP | 3.01 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.44 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|