C26H33N5O5S — CID 133076995
(4R,14S)-11-methyl-N-[3-(4-methyl-1,3-thiazol-2-yl)propyl]-9,12,16-trioxo-2-oxa-8,11,15-triazatricyclo[15.4.0.04,8]henicosa-1(21),17,19-triene-14-carboxamide (PubChem CID 133076995) has the molecular formula C26H33N5O5S and a molecular weight of 527.65 g/mol. Its IUPAC name is (4R,14S)-11-methyl-N-[3-(4-methyl-1,3-thiazol-2-yl)propyl]-9,12,16-trioxo-2-oxa-8,11,15-triazatricyclo[15.4.0.04,8]henicosa-1(21),17,19-triene-14-carboxamide.
| Compound Name | (4R,14S)-11-methyl-N-[3-(4-methyl-1,3-thiazol-2-yl)propyl]-9,12,16-trioxo-2-oxa-8,11,15-triazatricyclo[15.4.0.04,8]henicosa-1(21),17,19-triene-14-carboxamide |
|---|---|
| PubChem CID | 133076995 |
| Molecular Formula | C26H33N5O5S |
| Molecular Weight | 527.65 g/mol |
| Exact Mass | 527.22 |
| IUPAC Name | (4R,14S)-11-methyl-N-[3-(4-methyl-1,3-thiazol-2-yl)propyl]-9,12,16-trioxo-2-oxa-8,11,15-triazatricyclo[15.4.0.04,8]henicosa-1(21),17,19-triene-14-carboxamide |
| SMILES | Cc1csc(CCCNC(=O)[C@@H]2CC(=O)N(C)CC(=O)N3CCC[C@@H]3COc3ccccc3C(=O)N2)n1 |
| InChI | InChI=1S/C26H33N5O5S/c1-17-16-37-22(28-17)10-5-11-27-26(35)20-13-23(32)30(2)14-24(33)31-12-6-7-18(31)15-36-21-9-4-3-8-19(21)25(34)29-20/h3-4,8-9,16,18,20H,5-7,10-15H2,1-2H3,(H,27,35)(H,29,34)/t18-,20+/m1/s1 |
| InChIKey | AGGYRDRXWZJZOY-QUCCMNQESA-N |
| XLogP | 1.53 |
| TPSA | 120.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.65 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|