C33H41N5O5S — CID 133077469
(4R,7R,11S)-7-benzyl-4-(2-methylpropyl)-N-[3-(4-methyl-1,3-thiazol-2-yl)propyl]-6,9,13-trioxo-2-oxa-5,8,12-triazabicyclo[12.4.0]octadeca-1(18),14,16-triene-11-carboxamide (PubChem CID 133077469) has the molecular formula C33H41N5O5S and a molecular weight of 619.79 g/mol. Its IUPAC name is (4R,7R,11S)-7-benzyl-4-(2-methylpropyl)-N-[3-(4-methyl-1,3-thiazol-2-yl)propyl]-6,9,13-trioxo-2-oxa-5,8,12-triazabicyclo[12.4.0]octadeca-1(18),14,16-triene-11-carboxamide.
| Compound Name | (4R,7R,11S)-7-benzyl-4-(2-methylpropyl)-N-[3-(4-methyl-1,3-thiazol-2-yl)propyl]-6,9,13-trioxo-2-oxa-5,8,12-triazabicyclo[12.4.0]octadeca-1(18),14,16-triene-11-carboxamide |
|---|---|
| PubChem CID | 133077469 |
| Molecular Formula | C33H41N5O5S |
| Molecular Weight | 619.79 g/mol |
| Exact Mass | 619.28 |
| IUPAC Name | (4R,7R,11S)-7-benzyl-4-(2-methylpropyl)-N-[3-(4-methyl-1,3-thiazol-2-yl)propyl]-6,9,13-trioxo-2-oxa-5,8,12-triazabicyclo[12.4.0]octadeca-1(18),14,16-triene-11-carboxamide |
| SMILES | Cc1csc(CCCNC(=O)[C@@H]2CC(=O)N[C@H](Cc3ccccc3)C(=O)N[C@H](CC(C)C)COc3ccccc3C(=O)N2)n1 |
| InChI | InChI=1S/C33H41N5O5S/c1-21(2)16-24-19-43-28-13-8-7-12-25(28)31(40)38-27(32(41)34-15-9-14-30-35-22(3)20-44-30)18-29(39)37-26(33(42)36-24)17-23-10-5-4-6-11-23/h4-8,10-13,20-21,24,26-27H,9,14-19H2,1-3H3,(H,34,41)(H,36,42)(H,37,39)(H,38,40)/t24-,26-,27+/m1/s1 |
| InChIKey | PHWPNYVFTKGJRC-IEUSDUHPSA-N |
| XLogP | 3.34 |
| TPSA | 138.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.79 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|