C31H37N5O5S — CID 133075936
(11S)-8-benzyl-5-ethyl-N-[3-(4-methyl-1,3-thiazol-2-yl)propyl]-6,9,13-trioxo-2-oxa-5,8,12-triazabicyclo[12.4.0]octadeca-1(18),14,16-triene-11-carboxamide (PubChem CID 133075936) has the molecular formula C31H37N5O5S and a molecular weight of 591.73 g/mol. Its IUPAC name is (11S)-8-benzyl-5-ethyl-N-[3-(4-methyl-1,3-thiazol-2-yl)propyl]-6,9,13-trioxo-2-oxa-5,8,12-triazabicyclo[12.4.0]octadeca-1(18),14,16-triene-11-carboxamide.
| Compound Name | (11S)-8-benzyl-5-ethyl-N-[3-(4-methyl-1,3-thiazol-2-yl)propyl]-6,9,13-trioxo-2-oxa-5,8,12-triazabicyclo[12.4.0]octadeca-1(18),14,16-triene-11-carboxamide |
|---|---|
| PubChem CID | 133075936 |
| Molecular Formula | C31H37N5O5S |
| Molecular Weight | 591.73 g/mol |
| Exact Mass | 591.25 |
| IUPAC Name | (11S)-8-benzyl-5-ethyl-N-[3-(4-methyl-1,3-thiazol-2-yl)propyl]-6,9,13-trioxo-2-oxa-5,8,12-triazabicyclo[12.4.0]octadeca-1(18),14,16-triene-11-carboxamide |
| SMILES | CCN1CCOc2ccccc2C(=O)N[C@H](C(=O)NCCCc2nc(C)cs2)CC(=O)N(Cc2ccccc2)CC1=O |
| InChI | InChI=1S/C31H37N5O5S/c1-3-35-16-17-41-26-13-8-7-12-24(26)30(39)34-25(31(40)32-15-9-14-27-33-22(2)21-42-27)18-28(37)36(20-29(35)38)19-23-10-5-4-6-11-23/h4-8,10-13,21,25H,3,9,14-20H2,1-2H3,(H,32,40)(H,34,39)/t25-/m0/s1 |
| InChIKey | UEEWGJHHNBWIPP-VWLOTQADSA-N |
| XLogP | 2.96 |
| TPSA | 120.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.73 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|