C27H37N5O5S — CID 133075770
(4R,13S)-N-[3-(4-methyl-1,3-thiazol-2-yl)propyl]-6,10,15-trioxo-4-propan-2-yl-2-oxa-5,9,14-triazabicyclo[14.4.0]icosa-1(20),16,18-triene-13-carboxamide (PubChem CID 133075770) has the molecular formula C27H37N5O5S and a molecular weight of 543.69 g/mol. Its IUPAC name is (4R,13S)-N-[3-(4-methyl-1,3-thiazol-2-yl)propyl]-6,10,15-trioxo-4-propan-2-yl-2-oxa-5,9,14-triazabicyclo[14.4.0]icosa-1(20),16,18-triene-13-carboxamide.
| Compound Name | (4R,13S)-N-[3-(4-methyl-1,3-thiazol-2-yl)propyl]-6,10,15-trioxo-4-propan-2-yl-2-oxa-5,9,14-triazabicyclo[14.4.0]icosa-1(20),16,18-triene-13-carboxamide |
|---|---|
| PubChem CID | 133075770 |
| Molecular Formula | C27H37N5O5S |
| Molecular Weight | 543.69 g/mol |
| Exact Mass | 543.25 |
| IUPAC Name | (4R,13S)-N-[3-(4-methyl-1,3-thiazol-2-yl)propyl]-6,10,15-trioxo-4-propan-2-yl-2-oxa-5,9,14-triazabicyclo[14.4.0]icosa-1(20),16,18-triene-13-carboxamide |
| SMILES | Cc1csc(CCCNC(=O)[C@@H]2CCC(=O)NCCC(=O)N[C@H](C(C)C)COc3ccccc3C(=O)N2)n1 |
| InChI | InChI=1S/C27H37N5O5S/c1-17(2)21-15-37-22-8-5-4-7-19(22)26(35)32-20(10-11-23(33)28-14-12-24(34)31-21)27(36)29-13-6-9-25-30-18(3)16-38-25/h4-5,7-8,16-17,20-21H,6,9-15H2,1-3H3,(H,28,33)(H,29,36)(H,31,34)(H,32,35)/t20-,21-/m0/s1 |
| InChIKey | GCSIQZXUCRDOAY-SFTDATJTSA-N |
| XLogP | 2.12 |
| TPSA | 138.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.69 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|