C33H45N5O8Si — CID 140753565
2-trimethylsilylethyl N-[(4S,6S,13S)-11,15-dimethyl-9,12,16-trioxo-13-(phenylmethoxycarbonylamino)-2-oxa-8,11,15-triazatricyclo[15.3.1.04,8]henicosa-1(20),17(21),18-trien-6-yl]carbamate (PubChem CID 140753565) has the molecular formula C33H45N5O8Si and a molecular weight of 667.84 g/mol. Its IUPAC name is 2-trimethylsilylethyl N-[(4S,6S,13S)-11,15-dimethyl-9,12,16-trioxo-13-(phenylmethoxycarbonylamino)-2-oxa-8,11,15-triazatricyclo[15.3.1.04,8]henicosa-1(20),17(21),18-trien-6-yl]carbamate.
| Compound Name | 2-trimethylsilylethyl N-[(4S,6S,13S)-11,15-dimethyl-9,12,16-trioxo-13-(phenylmethoxycarbonylamino)-2-oxa-8,11,15-triazatricyclo[15.3.1.04,8]henicosa-1(20),17(21),18-trien-6-yl]carbamate |
|---|---|
| PubChem CID | 140753565 |
| Molecular Formula | C33H45N5O8Si |
| Molecular Weight | 667.84 g/mol |
| Exact Mass | 667.30 |
| IUPAC Name | 2-trimethylsilylethyl N-[(4S,6S,13S)-11,15-dimethyl-9,12,16-trioxo-13-(phenylmethoxycarbonylamino)-2-oxa-8,11,15-triazatricyclo[15.3.1.04,8]henicosa-1(20),17(21),18-trien-6-yl]carbamate |
| SMILES | CN1C[C@H](NC(=O)OCc2ccccc2)C(=O)N(C)CC(=O)N2C[C@@H](NC(=O)OCC[Si](C)(C)C)C[C@H]2COc2cccc(c2)C1=O |
| InChI | InChI=1S/C33H45N5O8Si/c1-36-19-28(35-33(43)46-21-23-10-7-6-8-11-23)31(41)37(2)20-29(39)38-18-25(34-32(42)44-14-15-47(3,4)5)17-26(38)22-45-27-13-9-12-24(16-27)30(36)40/h6-13,16,25-26,28H,14-15,17-22H2,1-5H3,(H,34,42)(H,35,43)/t25-,26-,28-/m0/s1 |
| InChIKey | ZXYLHOVOIUXIFC-NSVAZKTRSA-N |
| XLogP | 2.94 |
| TPSA | 146.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 47 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 667.84 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|