C19H18N4O6 — CID 152677017
benzyl N-[(5R,7R)-13-nitro-2-oxo-9-oxa-3,11-diazatricyclo[8.4.0.03,7]tetradeca-1(10),11,13-trien-5-yl]carbamate (PubChem CID 152677017) has the molecular formula C19H18N4O6 and a molecular weight of 398.38 g/mol. Its IUPAC name is benzyl N-[(5R,7R)-13-nitro-2-oxo-9-oxa-3,11-diazatricyclo[8.4.0.03,7]tetradeca-1(10),11,13-trien-5-yl]carbamate.
| Compound Name | benzyl N-[(5R,7R)-13-nitro-2-oxo-9-oxa-3,11-diazatricyclo[8.4.0.03,7]tetradeca-1(10),11,13-trien-5-yl]carbamate |
|---|---|
| PubChem CID | 152677017 |
| Molecular Formula | C19H18N4O6 |
| Molecular Weight | 398.38 g/mol |
| Exact Mass | 398.12 |
| IUPAC Name | benzyl N-[(5R,7R)-13-nitro-2-oxo-9-oxa-3,11-diazatricyclo[8.4.0.03,7]tetradeca-1(10),11,13-trien-5-yl]carbamate |
| SMILES | O=C(N[C@@H]1C[C@@H]2COc3ncc([N+](=O)[O-])cc3C(=O)N2C1)OCc1ccccc1 |
| InChI | InChI=1S/C19H18N4O6/c24-18-16-7-14(23(26)27)8-20-17(16)28-11-15-6-13(9-22(15)18)21-19(25)29-10-12-4-2-1-3-5-12/h1-5,7-8,13,15H,6,9-11H2,(H,21,25)/t13-,15-/m1/s1 |
| InChIKey | ZMSSLJYCGBYCQK-UKRRQHHQSA-N |
| XLogP | 1.89 |
| TPSA | 123.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.38 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|