C44H44N4O5 — CID 50996683
N-[(4S,6S,10S)-14-methyl-10-[(2-naphthalen-1-ylacetyl)amino]-9,15-dioxo-2-oxa-8,14-diazatricyclo[14.3.1.04,8]icosa-1(19),16(20),17-trien-6-yl]-2-(4-phenylphenyl)acetamide (PubChem CID 50996683) has the molecular formula C44H44N4O5 and a molecular weight of 708.86 g/mol. Its IUPAC name is N-[(4S,6S,10S)-14-methyl-10-[(2-naphthalen-1-ylacetyl)amino]-9,15-dioxo-2-oxa-8,14-diazatricyclo[14.3.1.04,8]icosa-1(19),16(20),17-trien-6-yl]-2-(4-phenylphenyl)acetamide.
| Compound Name | N-[(4S,6S,10S)-14-methyl-10-[(2-naphthalen-1-ylacetyl)amino]-9,15-dioxo-2-oxa-8,14-diazatricyclo[14.3.1.04,8]icosa-1(19),16(20),17-trien-6-yl]-2-(4-phenylphenyl)acetamide |
|---|---|
| PubChem CID | 50996683 |
| Molecular Formula | C44H44N4O5 |
| Molecular Weight | 708.86 g/mol |
| Exact Mass | 708.33 |
| IUPAC Name | N-[(4S,6S,10S)-14-methyl-10-[(2-naphthalen-1-ylacetyl)amino]-9,15-dioxo-2-oxa-8,14-diazatricyclo[14.3.1.04,8]icosa-1(19),16(20),17-trien-6-yl]-2-(4-phenylphenyl)acetamide |
| SMILES | CN1CCC[C@H](NC(=O)Cc2cccc3ccccc23)C(=O)N2C[C@@H](NC(=O)Cc3ccc(-c4ccccc4)cc3)C[C@H]2COc2cccc(c2)C1=O |
| InChI | InChI=1S/C44H44N4O5/c1-47-23-9-18-40(46-42(50)26-34-14-7-13-33-12-5-6-17-39(33)34)44(52)48-28-36(27-37(48)29-53-38-16-8-15-35(25-38)43(47)51)45-41(49)24-30-19-21-32(22-20-30)31-10-3-2-4-11-31/h2-8,10-17,19-22,25,36-37,40H,9,18,23-24,26-29H2,1H3,(H,45,49)(H,46,50)/t36-,37-,40-/m0/s1 |
| InChIKey | IEYZERXYHNBCOH-HKGQQODZSA-N |
| XLogP | 5.81 |
| TPSA | 108.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 708.86 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |