C38H42N6O5 — CID 50997032
N-[(4S,6S,10S)-6-[[3-(dimethylamino)phenyl]carbamoylamino]-9,15-dioxo-2-oxa-8,14-diazatricyclo[14.3.1.04,8]icosa-1(19),16(20),17-trien-10-yl]-2-naphthalen-2-ylacetamide (PubChem CID 50997032) has the molecular formula C38H42N6O5 and a molecular weight of 662.79 g/mol. Its IUPAC name is N-[(4S,6S,10S)-6-[[3-(dimethylamino)phenyl]carbamoylamino]-9,15-dioxo-2-oxa-8,14-diazatricyclo[14.3.1.04,8]icosa-1(19),16(20),17-trien-10-yl]-2-naphthalen-2-ylacetamide.
| Compound Name | N-[(4S,6S,10S)-6-[[3-(dimethylamino)phenyl]carbamoylamino]-9,15-dioxo-2-oxa-8,14-diazatricyclo[14.3.1.04,8]icosa-1(19),16(20),17-trien-10-yl]-2-naphthalen-2-ylacetamide |
|---|---|
| PubChem CID | 50997032 |
| Molecular Formula | C38H42N6O5 |
| Molecular Weight | 662.79 g/mol |
| Exact Mass | 662.32 |
| IUPAC Name | N-[(4S,6S,10S)-6-[[3-(dimethylamino)phenyl]carbamoylamino]-9,15-dioxo-2-oxa-8,14-diazatricyclo[14.3.1.04,8]icosa-1(19),16(20),17-trien-10-yl]-2-naphthalen-2-ylacetamide |
| SMILES | CN(C)c1cccc(NC(=O)N[C@H]2C[C@H]3COc4cccc(c4)C(=O)NCCC[C@H](NC(=O)Cc4ccc5ccccc5c4)C(=O)N3C2)c1 |
| InChI | InChI=1S/C38H42N6O5/c1-43(2)31-12-6-11-29(21-31)40-38(48)41-30-22-32-24-49-33-13-5-10-28(20-33)36(46)39-17-7-14-34(37(47)44(32)23-30)42-35(45)19-25-15-16-26-8-3-4-9-27(26)18-25/h3-6,8-13,15-16,18,20-21,30,32,34H,7,14,17,19,22-24H2,1-2H3,(H,39,46)(H,42,45)(H2,40,41,48)/t30-,32-,34-/m0/s1 |
| InChIKey | FCCCLZKNMYHRDI-AUNWAZDDSA-N |
| XLogP | 4.33 |
| TPSA | 132.11 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 49 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 662.79 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |