C28H30FN5O3 — CID 71744559
(9S,11R)-11-amino-16-[(3-fluorophenyl)methyl]-7-oxa-13,16,19,23-tetrazatetracyclo[19.3.1.12,6.09,13]hexacosa-1(25),2(26),3,5,21,23-hexaene-14,20-dione (PubChem CID 71744559) has the molecular formula C28H30FN5O3 and a molecular weight of 503.58 g/mol. Its IUPAC name is (9S,11R)-11-amino-16-[(3-fluorophenyl)methyl]-7-oxa-13,16,19,23-tetrazatetracyclo[19.3.1.12,6.09,13]hexacosa-1(25),2(26),3,5,21,23-hexaene-14,20-dione.
| Compound Name | (9S,11R)-11-amino-16-[(3-fluorophenyl)methyl]-7-oxa-13,16,19,23-tetrazatetracyclo[19.3.1.12,6.09,13]hexacosa-1(25),2(26),3,5,21,23-hexaene-14,20-dione |
|---|---|
| PubChem CID | 71744559 |
| Molecular Formula | C28H30FN5O3 |
| Molecular Weight | 503.58 g/mol |
| Exact Mass | 503.23 |
| IUPAC Name | (9S,11R)-11-amino-16-[(3-fluorophenyl)methyl]-7-oxa-13,16,19,23-tetrazatetracyclo[19.3.1.12,6.09,13]hexacosa-1(25),2(26),3,5,21,23-hexaene-14,20-dione |
| SMILES | N[C@@H]1C[C@H]2COc3cccc(c3)-c3cncc(c3)C(=O)NCCN(Cc3cccc(F)c3)CC(=O)N2C1 |
| InChI | InChI=1S/C28H30FN5O3/c29-23-5-1-3-19(9-23)15-33-8-7-32-28(36)22-10-21(13-31-14-22)20-4-2-6-26(11-20)37-18-25-12-24(30)16-34(25)27(35)17-33/h1-6,9-11,13-14,24-25H,7-8,12,15-18,30H2,(H,32,36)/t24-,25+/m1/s1 |
| InChIKey | QADJZDNORIXLAZ-RPBOFIJWSA-N |
| XLogP | 2.44 |
| TPSA | 100.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.58 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |