C17H36OSi — CID 123396547
2,2,3,3,5,12,12-heptamethyl-1-oxa-2-silacyclododecane (PubChem CID 123396547) has the molecular formula C17H36OSi and a molecular weight of 284.56 g/mol. Its IUPAC name is 2,2,3,3,5,12,12-heptamethyl-1-oxa-2-silacyclododecane.
| Compound Name | 2,2,3,3,5,12,12-heptamethyl-1-oxa-2-silacyclododecane |
|---|---|
| PubChem CID | 123396547 |
| Molecular Formula | C17H36OSi |
| Molecular Weight | 284.56 g/mol |
| Exact Mass | 284.25 |
| IUPAC Name | 2,2,3,3,5,12,12-heptamethyl-1-oxa-2-silacyclododecane |
| SMILES | CC1CCCCCCC(C)(C)O[Si](C)(C)C(C)(C)C1 |
| InChI | InChI=1S/C17H36OSi/c1-15-12-10-8-9-11-13-16(2,3)18-19(6,7)17(4,5)14-15/h15H,8-14H2,1-7H3 |
| InChIKey | WMQKZYAJYIMZLC-UHFFFAOYSA-N |
| XLogP | 6.15 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.56 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|