C13H22O3 — CID 123398085
2-(7-methoxy-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-1-yl)acetic acid (PubChem CID 123398085) has the molecular formula C13H22O3 and a molecular weight of 226.32 g/mol. Its IUPAC name is 2-(7-methoxy-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-1-yl)acetic acid.
| Compound Name | 2-(7-methoxy-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-1-yl)acetic acid |
|---|---|
| PubChem CID | 123398085 |
| Molecular Formula | C13H22O3 |
| Molecular Weight | 226.32 g/mol |
| Exact Mass | 226.16 |
| IUPAC Name | 2-(7-methoxy-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-1-yl)acetic acid |
| SMILES | COC1CCC2CCCC(CC(=O)O)C2C1 |
| InChI | InChI=1S/C13H22O3/c1-16-11-6-5-9-3-2-4-10(7-13(14)15)12(9)8-11/h9-12H,2-8H2,1H3,(H,14,15) |
| InChIKey | CEWOEFQZSZCRAC-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.32 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |