C17H30N2O4 — CID 123398823
3-(2,5-dihydroxy-3-propylpyrrol-1-yl)-N-[2-(3-methylbutoxy)ethyl]propanamide (PubChem CID 123398823) has the molecular formula C17H30N2O4 and a molecular weight of 326.44 g/mol. Its IUPAC name is 3-(2,5-dihydroxy-3-propylpyrrol-1-yl)-N-[2-(3-methylbutoxy)ethyl]propanamide.
| Compound Name | 3-(2,5-dihydroxy-3-propylpyrrol-1-yl)-N-[2-(3-methylbutoxy)ethyl]propanamide |
|---|---|
| PubChem CID | 123398823 |
| Molecular Formula | C17H30N2O4 |
| Molecular Weight | 326.44 g/mol |
| Exact Mass | 326.22 |
| IUPAC Name | 3-(2,5-dihydroxy-3-propylpyrrol-1-yl)-N-[2-(3-methylbutoxy)ethyl]propanamide |
| SMILES | CCCc1cc(O)n(CCC(=O)NCCOCCC(C)C)c1O |
| InChI | InChI=1S/C17H30N2O4/c1-4-5-14-12-16(21)19(17(14)22)9-6-15(20)18-8-11-23-10-7-13(2)3/h12-13,21-22H,4-11H2,1-3H3,(H,18,20) |
| InChIKey | AWOHPQXEAMQKJO-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 83.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.44 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|