C23H40N2O3 — CID 90984788
5-(2,5-dihydroxy-3-propan-2-ylpyrrol-1-yl)-N-(2-ethyl-3-methylbut-2-enyl)-3,3,5-trimethylhexanamide (PubChem CID 90984788) has the molecular formula C23H40N2O3 and a molecular weight of 392.58 g/mol. Its IUPAC name is 5-(2,5-dihydroxy-3-propan-2-ylpyrrol-1-yl)-N-(2-ethyl-3-methylbut-2-enyl)-3,3,5-trimethylhexanamide.
| Compound Name | 5-(2,5-dihydroxy-3-propan-2-ylpyrrol-1-yl)-N-(2-ethyl-3-methylbut-2-enyl)-3,3,5-trimethylhexanamide |
|---|---|
| PubChem CID | 90984788 |
| Molecular Formula | C23H40N2O3 |
| Molecular Weight | 392.58 g/mol |
| Exact Mass | 392.30 |
| IUPAC Name | 5-(2,5-dihydroxy-3-propan-2-ylpyrrol-1-yl)-N-(2-ethyl-3-methylbut-2-enyl)-3,3,5-trimethylhexanamide |
| SMILES | CCC(CNC(=O)CC(C)(C)CC(C)(C)n1c(O)cc(C(C)C)c1O)=C(C)C |
| InChI | InChI=1S/C23H40N2O3/c1-10-17(15(2)3)13-24-19(26)12-22(6,7)14-23(8,9)25-20(27)11-18(16(4)5)21(25)28/h11,16,27-28H,10,12-14H2,1-9H3,(H,24,26) |
| InChIKey | OQLCVSFQACLNMW-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 74.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.58 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|