C40H60N2O3S — CID 90814151
5-[3-(9-ethyl-5-methyl-14-propylcyclotetradeca-1,3,5,7,9,11,13-heptaen-1-yl)sulfanyl-2,5-dihydroxypyrrol-1-yl]-N-(3-ethylpentyl)-3,3,5-trimethylhexanamide (PubChem CID 90814151) has the molecular formula C40H60N2O3S and a molecular weight of 649.00 g/mol. Its IUPAC name is 5-[3-(9-ethyl-5-methyl-14-propylcyclotetradeca-1,3,5,7,9,11,13-heptaen-1-yl)sulfanyl-2,5-dihydroxypyrrol-1-yl]-N-(3-ethylpentyl)-3,3,5-trimethylhexanamide.
| Compound Name | 5-[3-(9-ethyl-5-methyl-14-propylcyclotetradeca-1,3,5,7,9,11,13-heptaen-1-yl)sulfanyl-2,5-dihydroxypyrrol-1-yl]-N-(3-ethylpentyl)-3,3,5-trimethylhexanamide |
|---|---|
| PubChem CID | 90814151 |
| Molecular Formula | C40H60N2O3S |
| Molecular Weight | 649.00 g/mol |
| Exact Mass | 648.43 |
| IUPAC Name | 5-[3-(9-ethyl-5-methyl-14-propylcyclotetradeca-1,3,5,7,9,11,13-heptaen-1-yl)sulfanyl-2,5-dihydroxypyrrol-1-yl]-N-(3-ethylpentyl)-3,3,5-trimethylhexanamide |
| SMILES | CCCc1ccccc(CC)cccc(C)cccc1Sc1cc(O)n(C(C)(C)CC(C)(C)CC(=O)NCCC(CC)CC)c1O |
| InChI | InChI=1S/C40H60N2O3S/c1-10-18-33-23-15-14-21-32(13-4)22-16-19-30(5)20-17-24-34(33)46-35-27-37(44)42(38(35)45)40(8,9)29-39(6,7)28-36(43)41-26-25-31(11-2)12-3/h14-17,19-24,27,31,44-45H,10-13,18,25-26,28-29H2,1-9H3,(H,41,43)/b15-14-,19-16+,20-17-,21-14-,22-16-,23-15+,24-17+,30-19+,30-20-,32-21+,32-22+,33-23+,34-24-,34-33+ |
| InChIKey | BCPSRCVQDXEMIS-AIGMJWIVSA-N |
| XLogP | 10.61 |
| TPSA | 74.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 649.00 |
| LogP ≤ 5 | 10.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |