C28H50N2O4S — CID 90807905
N-[4-[3-(3-acetyl-4-methylpentyl)sulfanyl-2,5-dihydroxypyrrol-1-yl]-2,4-dimethylpentan-2-yl]-2,2,4,4-tetramethylpentanamide (PubChem CID 90807905) has the molecular formula C28H50N2O4S and a molecular weight of 510.79 g/mol. Its IUPAC name is N-[4-[3-(3-acetyl-4-methylpentyl)sulfanyl-2,5-dihydroxypyrrol-1-yl]-2,4-dimethylpentan-2-yl]-2,2,4,4-tetramethylpentanamide.
| Compound Name | N-[4-[3-(3-acetyl-4-methylpentyl)sulfanyl-2,5-dihydroxypyrrol-1-yl]-2,4-dimethylpentan-2-yl]-2,2,4,4-tetramethylpentanamide |
|---|---|
| PubChem CID | 90807905 |
| Molecular Formula | C28H50N2O4S |
| Molecular Weight | 510.79 g/mol |
| Exact Mass | 510.35 |
| IUPAC Name | N-[4-[3-(3-acetyl-4-methylpentyl)sulfanyl-2,5-dihydroxypyrrol-1-yl]-2,4-dimethylpentan-2-yl]-2,2,4,4-tetramethylpentanamide |
| SMILES | CC(=O)C(CCSc1cc(O)n(C(C)(C)CC(C)(C)NC(=O)C(C)(C)CC(C)(C)C)c1O)C(C)C |
| InChI | InChI=1S/C28H50N2O4S/c1-18(2)20(19(3)31)13-14-35-21-15-22(32)30(23(21)33)28(11,12)17-27(9,10)29-24(34)26(7,8)16-25(4,5)6/h15,18,20,32-33H,13-14,16-17H2,1-12H3,(H,29,34) |
| InChIKey | HFFIFNPAXCGJJT-UHFFFAOYSA-N |
| XLogP | 6.73 |
| TPSA | 91.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.79 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |