C19H34N2O3S — CID 90780499
6-(3-ethylsulfanyl-2,5-dihydroxypyrrol-1-yl)-N-(5-methylhexyl)hexanamide (PubChem CID 90780499) has the molecular formula C19H34N2O3S and a molecular weight of 370.56 g/mol. Its IUPAC name is 6-(3-ethylsulfanyl-2,5-dihydroxypyrrol-1-yl)-N-(5-methylhexyl)hexanamide.
| Compound Name | 6-(3-ethylsulfanyl-2,5-dihydroxypyrrol-1-yl)-N-(5-methylhexyl)hexanamide |
|---|---|
| PubChem CID | 90780499 |
| Molecular Formula | C19H34N2O3S |
| Molecular Weight | 370.56 g/mol |
| Exact Mass | 370.23 |
| IUPAC Name | 6-(3-ethylsulfanyl-2,5-dihydroxypyrrol-1-yl)-N-(5-methylhexyl)hexanamide |
| SMILES | CCSc1cc(O)n(CCCCCC(=O)NCCCCC(C)C)c1O |
| InChI | InChI=1S/C19H34N2O3S/c1-4-25-16-14-18(23)21(19(16)24)13-9-5-6-11-17(22)20-12-8-7-10-15(2)3/h14-15,23-24H,4-13H2,1-3H3,(H,20,22) |
| InChIKey | HJYOAIKRDKYSHI-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 74.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.56 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|