C18H32N2O4S — CID 90783319
6-(3-ethylsulfanyl-2,5-dihydroxypyrrol-1-yl)-N-(6-hydroxyhexyl)hexanamide (PubChem CID 90783319) has the molecular formula C18H32N2O4S and a molecular weight of 372.53 g/mol. Its IUPAC name is 6-(3-ethylsulfanyl-2,5-dihydroxypyrrol-1-yl)-N-(6-hydroxyhexyl)hexanamide.
| Compound Name | 6-(3-ethylsulfanyl-2,5-dihydroxypyrrol-1-yl)-N-(6-hydroxyhexyl)hexanamide |
|---|---|
| PubChem CID | 90783319 |
| Molecular Formula | C18H32N2O4S |
| Molecular Weight | 372.53 g/mol |
| Exact Mass | 372.21 |
| IUPAC Name | 6-(3-ethylsulfanyl-2,5-dihydroxypyrrol-1-yl)-N-(6-hydroxyhexyl)hexanamide |
| SMILES | CCSc1cc(O)n(CCCCCC(=O)NCCCCCCO)c1O |
| InChI | InChI=1S/C18H32N2O4S/c1-2-25-15-14-17(23)20(18(15)24)12-8-5-6-10-16(22)19-11-7-3-4-9-13-21/h14,21,23-24H,2-13H2,1H3,(H,19,22) |
| InChIKey | FMHWHEFKVBFMLQ-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 94.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.53 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|