C22H39N3O4S — CID 90794490
N-(5-acetamido-6-methylheptyl)-6-(3-ethylsulfanyl-2,5-dihydroxypyrrol-1-yl)hexanamide (PubChem CID 90794490) has the molecular formula C22H39N3O4S and a molecular weight of 441.64 g/mol. Its IUPAC name is N-(5-acetamido-6-methylheptyl)-6-(3-ethylsulfanyl-2,5-dihydroxypyrrol-1-yl)hexanamide.
| Compound Name | N-(5-acetamido-6-methylheptyl)-6-(3-ethylsulfanyl-2,5-dihydroxypyrrol-1-yl)hexanamide |
|---|---|
| PubChem CID | 90794490 |
| Molecular Formula | C22H39N3O4S |
| Molecular Weight | 441.64 g/mol |
| Exact Mass | 441.27 |
| IUPAC Name | N-(5-acetamido-6-methylheptyl)-6-(3-ethylsulfanyl-2,5-dihydroxypyrrol-1-yl)hexanamide |
| SMILES | CCSc1cc(O)n(CCCCCC(=O)NCCCCC(NC(C)=O)C(C)C)c1O |
| InChI | InChI=1S/C22H39N3O4S/c1-5-30-19-15-21(28)25(22(19)29)14-10-6-7-12-20(27)23-13-9-8-11-18(16(2)3)24-17(4)26/h15-16,18,28-29H,5-14H2,1-4H3,(H,23,27)(H,24,26) |
| InChIKey | URDGNOYAHGDEJS-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 103.59 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.64 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|