C21H32N2O7S — CID 54419810
6-[[4-[[3-(2-carboxyethylsulfanyl)-2,5-dihydroxypyrrol-1-yl]methyl]cyclohexanecarbonyl]amino]hexanoic acid (PubChem CID 54419810) has the molecular formula C21H32N2O7S and a molecular weight of 456.56 g/mol. Its IUPAC name is 6-[[4-[[3-(2-carboxyethylsulfanyl)-2,5-dihydroxypyrrol-1-yl]methyl]cyclohexanecarbonyl]amino]hexanoic acid.
| Compound Name | 6-[[4-[[3-(2-carboxyethylsulfanyl)-2,5-dihydroxypyrrol-1-yl]methyl]cyclohexanecarbonyl]amino]hexanoic acid |
|---|---|
| PubChem CID | 54419810 |
| Molecular Formula | C21H32N2O7S |
| Molecular Weight | 456.56 g/mol |
| Exact Mass | 456.19 |
| IUPAC Name | 6-[[4-[[3-(2-carboxyethylsulfanyl)-2,5-dihydroxypyrrol-1-yl]methyl]cyclohexanecarbonyl]amino]hexanoic acid |
| SMILES | O=C(O)CCCCCNC(=O)C1CCC(Cn2c(O)cc(SCCC(=O)O)c2O)CC1 |
| InChI | InChI=1S/C21H32N2O7S/c24-17-12-16(31-11-9-19(27)28)21(30)23(17)13-14-5-7-15(8-6-14)20(29)22-10-3-1-2-4-18(25)26/h12,14-15,24,30H,1-11,13H2,(H,22,29)(H,25,26)(H,27,28) |
| InChIKey | VZZKRAJNABNRGU-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 149.09 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.56 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|