C25H45N3O4S — CID 91055268
4-[2,5-dihydroxy-3-[2-(methylamino)-3-oxobutyl]sulfanylpyrrol-1-yl]-2,2,4-trimethyl-N-(2,4,4-trimethylpentan-2-yl)pentanamide (PubChem CID 91055268) has the molecular formula C25H45N3O4S and a molecular weight of 483.72 g/mol. Its IUPAC name is 4-[2,5-dihydroxy-3-[2-(methylamino)-3-oxobutyl]sulfanylpyrrol-1-yl]-2,2,4-trimethyl-N-(2,4,4-trimethylpentan-2-yl)pentanamide.
| Compound Name | 4-[2,5-dihydroxy-3-[2-(methylamino)-3-oxobutyl]sulfanylpyrrol-1-yl]-2,2,4-trimethyl-N-(2,4,4-trimethylpentan-2-yl)pentanamide |
|---|---|
| PubChem CID | 91055268 |
| Molecular Formula | C25H45N3O4S |
| Molecular Weight | 483.72 g/mol |
| Exact Mass | 483.31 |
| IUPAC Name | 4-[2,5-dihydroxy-3-[2-(methylamino)-3-oxobutyl]sulfanylpyrrol-1-yl]-2,2,4-trimethyl-N-(2,4,4-trimethylpentan-2-yl)pentanamide |
| SMILES | CNC(CSc1cc(O)n(C(C)(C)CC(C)(C)C(=O)NC(C)(C)CC(C)(C)C)c1O)C(C)=O |
| InChI | InChI=1S/C25H45N3O4S/c1-16(29)17(26-11)13-33-18-12-19(30)28(20(18)31)25(9,10)15-23(5,6)21(32)27-24(7,8)14-22(2,3)4/h12,17,26,30-31H,13-15H2,1-11H3,(H,27,32) |
| InChIKey | DKYHQERRFOMTDW-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 103.59 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.72 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |