C27H52N6O3 — CID 90934104
2-amino-N-[3-[2,5-dihydroxy-1-(3-methylhexan-3-yl)pyrrol-3-yl]propyl]-5-[[N'-methyl-N-(2-methylpentyl)carbamimidoyl]amino]pentanamide (PubChem CID 90934104) has the molecular formula C27H52N6O3 and a molecular weight of 508.75 g/mol. Its IUPAC name is 2-amino-N-[3-[2,5-dihydroxy-1-(3-methylhexan-3-yl)pyrrol-3-yl]propyl]-5-[[N'-methyl-N-(2-methylpentyl)carbamimidoyl]amino]pentanamide.
| Compound Name | 2-amino-N-[3-[2,5-dihydroxy-1-(3-methylhexan-3-yl)pyrrol-3-yl]propyl]-5-[[N'-methyl-N-(2-methylpentyl)carbamimidoyl]amino]pentanamide |
|---|---|
| PubChem CID | 90934104 |
| Molecular Formula | C27H52N6O3 |
| Molecular Weight | 508.75 g/mol |
| Exact Mass | 508.41 |
| IUPAC Name | 2-amino-N-[3-[2,5-dihydroxy-1-(3-methylhexan-3-yl)pyrrol-3-yl]propyl]-5-[[N'-methyl-N-(2-methylpentyl)carbamimidoyl]amino]pentanamide |
| SMILES | CCCC(C)CN/C(=N\C)NCCCC(N)C(=O)NCCCc1cc(O)n(C(C)(CC)CCC)c1O |
| InChI | InChI=1S/C27H52N6O3/c1-7-12-20(4)19-32-26(29-6)31-17-11-14-22(28)24(35)30-16-10-13-21-18-23(34)33(25(21)36)27(5,9-3)15-8-2/h18,20,22,34,36H,7-17,19,28H2,1-6H3,(H,30,35)(H2,29,31,32) |
| InChIKey | HKQFWHFAUSUKSB-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 136.93 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.75 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|