C22H40N2O3 — CID 123139788
4-[2,5-dihydroxy-3-(2-propylheptyl)pyrrol-1-yl]-2,2,4-trimethylpentanamide (PubChem CID 123139788) has the molecular formula C22H40N2O3 and a molecular weight of 380.57 g/mol. Its IUPAC name is 4-[2,5-dihydroxy-3-(2-propylheptyl)pyrrol-1-yl]-2,2,4-trimethylpentanamide.
| Compound Name | 4-[2,5-dihydroxy-3-(2-propylheptyl)pyrrol-1-yl]-2,2,4-trimethylpentanamide |
|---|---|
| PubChem CID | 123139788 |
| Molecular Formula | C22H40N2O3 |
| Molecular Weight | 380.57 g/mol |
| Exact Mass | 380.30 |
| IUPAC Name | 4-[2,5-dihydroxy-3-(2-propylheptyl)pyrrol-1-yl]-2,2,4-trimethylpentanamide |
| SMILES | CCCCCC(CCC)Cc1cc(O)n(C(C)(C)CC(C)(C)C(N)=O)c1O |
| InChI | InChI=1S/C22H40N2O3/c1-7-9-10-12-16(11-8-2)13-17-14-18(25)24(19(17)26)22(5,6)15-21(3,4)20(23)27/h14,16,25-26H,7-13,15H2,1-6H3,(H2,23,27) |
| InChIKey | ZSVKZOWICMNJGF-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 88.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.57 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|