C31H62 — CID 123398871
1-[3-ethyl-2,4,6-trimethyl-5-(4-methyloctyl)tridecyl]-2-methylcyclopropane (PubChem CID 123398871) has the molecular formula C31H62 and a molecular weight of 434.84 g/mol. Its IUPAC name is 1-[3-ethyl-2,4,6-trimethyl-5-(4-methyloctyl)tridecyl]-2-methylcyclopropane.
| Compound Name | 1-[3-ethyl-2,4,6-trimethyl-5-(4-methyloctyl)tridecyl]-2-methylcyclopropane |
|---|---|
| PubChem CID | 123398871 |
| Molecular Formula | C31H62 |
| Molecular Weight | 434.84 g/mol |
| Exact Mass | 434.49 |
| IUPAC Name | 1-[3-ethyl-2,4,6-trimethyl-5-(4-methyloctyl)tridecyl]-2-methylcyclopropane |
| SMILES | CCCCCCCC(C)C(CCCC(C)CCCC)C(C)C(CC)C(C)CC1CC1C |
| InChI | InChI=1S/C31H62/c1-9-12-14-15-16-20-25(5)31(21-17-19-24(4)18-13-10-2)28(8)30(11-3)27(7)23-29-22-26(29)6/h24-31H,9-23H2,1-8H3 |
| InChIKey | AJIYOQLLGGIEMG-UHFFFAOYSA-N |
| XLogP | 10.94 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 20 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.84 |
| LogP ≤ 5 | 10.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|