C24H19F4N5O2S — CID 123399249
N-[3-[(amino-methyl-oxo-λ6-sulfanylidene)methyl]phenyl]-4-[4-fluoro-2-[(3,4,5-trifluorophenyl)methoxy]phenyl]-1,3,5-triazin-2-amine (PubChem CID 123399249) has the molecular formula C24H19F4N5O2S and a molecular weight of 517.51 g/mol. Its IUPAC name is N-[3-[(amino-methyl-oxo-λ6-sulfanylidene)methyl]phenyl]-4-[4-fluoro-2-[(3,4,5-trifluorophenyl)methoxy]phenyl]-1,3,5-triazin-2-amine.
| Compound Name | N-[3-[(amino-methyl-oxo-λ6-sulfanylidene)methyl]phenyl]-4-[4-fluoro-2-[(3,4,5-trifluorophenyl)methoxy]phenyl]-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 123399249 |
| Molecular Formula | C24H19F4N5O2S |
| Molecular Weight | 517.51 g/mol |
| Exact Mass | 517.12 |
| IUPAC Name | N-[3-[(amino-methyl-oxo-λ6-sulfanylidene)methyl]phenyl]-4-[4-fluoro-2-[(3,4,5-trifluorophenyl)methoxy]phenyl]-1,3,5-triazin-2-amine |
| SMILES | CS(N)(=O)=Cc1cccc(Nc2ncnc(-c3ccc(F)cc3OCc3cc(F)c(F)c(F)c3)n2)c1 |
| InChI | InChI=1S/C24H19F4N5O2S/c1-36(29,34)12-14-3-2-4-17(7-14)32-24-31-13-30-23(33-24)18-6-5-16(25)10-21(18)35-11-15-8-19(26)22(28)20(27)9-15/h2-10,12-13H,11H2,1H3,(H2,29,34)(H,30,31,32,33) |
| InChIKey | FYMKTAZBZRNVLM-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 103.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.51 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thio_aldehyd_A(3)', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|