C24H18F4N4O3S — CID 66575973
4-[4-fluoro-2-[(2,4,5-trifluorophenyl)methoxy]phenyl]-N-[3-(methylsulfonylmethyl)phenyl]-1,3,5-triazin-2-amine (PubChem CID 66575973) has the molecular formula C24H18F4N4O3S and a molecular weight of 518.49 g/mol. Its IUPAC name is 4-[4-fluoro-2-[(2,4,5-trifluorophenyl)methoxy]phenyl]-N-[3-(methylsulfonylmethyl)phenyl]-1,3,5-triazin-2-amine.
| Compound Name | 4-[4-fluoro-2-[(2,4,5-trifluorophenyl)methoxy]phenyl]-N-[3-(methylsulfonylmethyl)phenyl]-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 66575973 |
| Molecular Formula | C24H18F4N4O3S |
| Molecular Weight | 518.49 g/mol |
| Exact Mass | 518.10 |
| IUPAC Name | 4-[4-fluoro-2-[(2,4,5-trifluorophenyl)methoxy]phenyl]-N-[3-(methylsulfonylmethyl)phenyl]-1,3,5-triazin-2-amine |
| SMILES | CS(=O)(=O)Cc1cccc(Nc2ncnc(-c3ccc(F)cc3OCc3cc(F)c(F)cc3F)n2)c1 |
| InChI | InChI=1S/C24H18F4N4O3S/c1-36(33,34)12-14-3-2-4-17(7-14)31-24-30-13-29-23(32-24)18-6-5-16(25)9-22(18)35-11-15-8-20(27)21(28)10-19(15)26/h2-10,13H,11-12H2,1H3,(H,29,30,31,32) |
| InChIKey | NFCSGUGAJSLLRF-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 94.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.49 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|