C25H23FN6O2 — CID 123399651
3-[4-[3-fluoro-5-[(2-methylpyrimidin-5-yl)methoxy]phenoxy]phenyl]-4-isocyano-1-propan-2-ylpyrazol-5-amine (PubChem CID 123399651) has the molecular formula C25H23FN6O2 and a molecular weight of 458.50 g/mol. Its IUPAC name is 3-[4-[3-fluoro-5-[(2-methylpyrimidin-5-yl)methoxy]phenoxy]phenyl]-4-isocyano-1-propan-2-ylpyrazol-5-amine.
| Compound Name | 3-[4-[3-fluoro-5-[(2-methylpyrimidin-5-yl)methoxy]phenoxy]phenyl]-4-isocyano-1-propan-2-ylpyrazol-5-amine |
|---|---|
| PubChem CID | 123399651 |
| Molecular Formula | C25H23FN6O2 |
| Molecular Weight | 458.50 g/mol |
| Exact Mass | 458.19 |
| IUPAC Name | 3-[4-[3-fluoro-5-[(2-methylpyrimidin-5-yl)methoxy]phenoxy]phenyl]-4-isocyano-1-propan-2-ylpyrazol-5-amine |
| SMILES | [C-]#[N+]c1c(-c2ccc(Oc3cc(F)cc(OCc4cnc(C)nc4)c3)cc2)nn(C(C)C)c1N |
| InChI | InChI=1S/C25H23FN6O2/c1-15(2)32-25(27)24(28-4)23(31-32)18-5-7-20(8-6-18)34-22-10-19(26)9-21(11-22)33-14-17-12-29-16(3)30-13-17/h5-13,15H,14,27H2,1-3H3 |
| InChIKey | HZZVJBLPRZCVNM-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 92.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.50 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|