C19H17FN4O2 — CID 129170909
4-[3-fluoro-5-[(2-methylpyrimidin-5-yl)methoxy]phenoxy]-N-(methylideneamino)aniline (PubChem CID 129170909) has the molecular formula C19H17FN4O2 and a molecular weight of 352.37 g/mol. Its IUPAC name is 4-[3-fluoro-5-[(2-methylpyrimidin-5-yl)methoxy]phenoxy]-N-(methylideneamino)aniline.
| Compound Name | 4-[3-fluoro-5-[(2-methylpyrimidin-5-yl)methoxy]phenoxy]-N-(methylideneamino)aniline |
|---|---|
| PubChem CID | 129170909 |
| Molecular Formula | C19H17FN4O2 |
| Molecular Weight | 352.37 g/mol |
| Exact Mass | 352.13 |
| IUPAC Name | 4-[3-fluoro-5-[(2-methylpyrimidin-5-yl)methoxy]phenoxy]-N-(methylideneamino)aniline |
| SMILES | C=NNc1ccc(Oc2cc(F)cc(OCc3cnc(C)nc3)c2)cc1 |
| InChI | InChI=1S/C19H17FN4O2/c1-13-22-10-14(11-23-13)12-25-18-7-15(20)8-19(9-18)26-17-5-3-16(4-6-17)24-21-2/h3-11,24H,2,12H2,1H3 |
| InChIKey | FPYJBFAXSGHFBC-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 68.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.37 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|