C15H21N3O2 — CID 123399905
5-ethyl-7-[2-(oxan-2-yloxy)ethyl]pyrrolo[2,3-d]pyrimidine (PubChem CID 123399905) has the molecular formula C15H21N3O2 and a molecular weight of 275.35 g/mol. Its IUPAC name is 5-ethyl-7-[2-(oxan-2-yloxy)ethyl]pyrrolo[2,3-d]pyrimidine.
| Compound Name | 5-ethyl-7-[2-(oxan-2-yloxy)ethyl]pyrrolo[2,3-d]pyrimidine |
|---|---|
| PubChem CID | 123399905 |
| Molecular Formula | C15H21N3O2 |
| Molecular Weight | 275.35 g/mol |
| Exact Mass | 275.16 |
| IUPAC Name | 5-ethyl-7-[2-(oxan-2-yloxy)ethyl]pyrrolo[2,3-d]pyrimidine |
| SMILES | CCc1cn(CCOC2CCCCO2)c2ncncc12 |
| InChI | InChI=1S/C15H21N3O2/c1-2-12-10-18(15-13(12)9-16-11-17-15)6-8-20-14-5-3-4-7-19-14/h9-11,14H,2-8H2,1H3 |
| InChIKey | JQEACTWYPBXWMD-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 49.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.35 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |