C12H25NO — CID 123400284
1,3,5,5,7,7-hexamethylazepan-3-ol (PubChem CID 123400284) has the molecular formula C12H25NO and a molecular weight of 199.34 g/mol. Its IUPAC name is 1,3,5,5,7,7-hexamethylazepan-3-ol.
| Compound Name | 1,3,5,5,7,7-hexamethylazepan-3-ol |
|---|---|
| PubChem CID | 123400284 |
| Molecular Formula | C12H25NO |
| Molecular Weight | 199.34 g/mol |
| Exact Mass | 199.19 |
| IUPAC Name | 1,3,5,5,7,7-hexamethylazepan-3-ol |
| SMILES | CN1CC(C)(O)CC(C)(C)CC1(C)C |
| InChI | InChI=1S/C12H25NO/c1-10(2)7-11(3,4)13(6)9-12(5,14)8-10/h14H,7-9H2,1-6H3 |
| InChIKey | VVPFZINKMPVTMP-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.34 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |