C22H47NO2 — CID 123400584
2-amino-12,16-dimethylicosane-3,10-diol (PubChem CID 123400584) has the molecular formula C22H47NO2 and a molecular weight of 357.62 g/mol. Its IUPAC name is 2-amino-12,16-dimethylicosane-3,10-diol.
| Compound Name | 2-amino-12,16-dimethylicosane-3,10-diol |
|---|---|
| PubChem CID | 123400584 |
| Molecular Formula | C22H47NO2 |
| Molecular Weight | 357.62 g/mol |
| Exact Mass | 357.36 |
| IUPAC Name | 2-amino-12,16-dimethylicosane-3,10-diol |
| SMILES | CCCCC(C)CCCC(C)CC(O)CCCCCCC(O)C(C)N |
| InChI | InChI=1S/C22H47NO2/c1-5-6-12-18(2)13-11-14-19(3)17-21(24)15-9-7-8-10-16-22(25)20(4)23/h18-22,24-25H,5-17,23H2,1-4H3 |
| InChIKey | TZJFCFJAEJZJSU-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.62 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|