C26H33Cl2F4N4O2S+ — CID 123400757
[4-[2-tert-butylsulfanylethyl-[2-(2,6-dichloro-4-fluorophenyl)-2-oxoethyl]amino]-1,1,1-trifluoro-3-methanimidoyl-4-oxobut-2-en-2-yl]-imino-(4-methylcyclohexyl)azanium (PubChem CID 123400757) has the molecular formula C26H33Cl2F4N4O2S+ and a molecular weight of 612.54 g/mol. Its IUPAC name is [4-[2-tert-butylsulfanylethyl-[2-(2,6-dichloro-4-fluorophenyl)-2-oxoethyl]amino]-1,1,1-trifluoro-3-methanimidoyl-4-oxobut-2-en-2-yl]-imino-(4-methylcyclohexyl)azanium.
| Compound Name | [4-[2-tert-butylsulfanylethyl-[2-(2,6-dichloro-4-fluorophenyl)-2-oxoethyl]amino]-1,1,1-trifluoro-3-methanimidoyl-4-oxobut-2-en-2-yl]-imino-(4-methylcyclohexyl)azanium |
|---|---|
| PubChem CID | 123400757 |
| Molecular Formula | C26H33Cl2F4N4O2S+ |
| Molecular Weight | 612.54 g/mol |
| Exact Mass | 611.16 |
| IUPAC Name | [4-[2-tert-butylsulfanylethyl-[2-(2,6-dichloro-4-fluorophenyl)-2-oxoethyl]amino]-1,1,1-trifluoro-3-methanimidoyl-4-oxobut-2-en-2-yl]-imino-(4-methylcyclohexyl)azanium |
| SMILES | [H]/N=C/C(C(=O)N(CCSC(C)(C)C)CC(=O)c1c(Cl)cc(F)cc1Cl)=C(/[N+](=N/[H])C1CCC(C)CC1)C(F)(F)F |
| InChI | InChI=1S/C26H33Cl2F4N4O2S/c1-15-5-7-17(8-6-15)36(34)23(26(30,31)32)18(13-33)24(38)35(9-10-39-25(2,3)4)14-21(37)22-19(27)11-16(29)12-20(22)28/h11-13,15,17,33-34H,5-10,14H2,1-4H3/q+1/b23-18?,33-13+,36-34+ |
| InChIKey | PJUSAEFYULFQLT-KSUGIUFASA-N |
| XLogP | 7.76 |
| TPSA | 88.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.54 |
| LogP ≤ 5 | 7.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|