C18H14N3O3S2- — CID 123402587
2-methyl-3-oxo-6-[5-[5-(sulfinatoamino)-3-pyridinyl]thiophen-2-yl]-1H-isoindole (PubChem CID 123402587) has the molecular formula C18H14N3O3S2- and a molecular weight of 384.46 g/mol. Its IUPAC name is 2-methyl-3-oxo-6-[5-[5-(sulfinatoamino)-3-pyridinyl]thiophen-2-yl]-1H-isoindole.
| Compound Name | 2-methyl-3-oxo-6-[5-[5-(sulfinatoamino)-3-pyridinyl]thiophen-2-yl]-1H-isoindole |
|---|---|
| PubChem CID | 123402587 |
| Molecular Formula | C18H14N3O3S2- |
| Molecular Weight | 384.46 g/mol |
| Exact Mass | 384.05 |
| IUPAC Name | 2-methyl-3-oxo-6-[5-[5-(sulfinatoamino)-3-pyridinyl]thiophen-2-yl]-1H-isoindole |
| SMILES | CN1Cc2cc(-c3ccc(-c4cncc(NS(=O)[O-])c4)s3)ccc2C1=O |
| InChI | InChI=1S/C18H15N3O3S2/c1-21-10-13-6-11(2-3-15(13)18(21)22)16-4-5-17(25-16)12-7-14(9-19-8-12)20-26(23)24/h2-9,20H,10H2,1H3,(H,23,24)/p-1 |
| InChIKey | DLOHRPFUOKNTFC-UHFFFAOYSA-M |
| XLogP | 3.27 |
| TPSA | 85.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.46 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|