C26H23N3O3S2 — CID 144576220
5-[5-[5-[(3,4-dimethoxyphenyl)sulfanylamino]-3-pyridinyl]thiophen-2-yl]-2-methyl-3H-isoindol-1-one (PubChem CID 144576220) has the molecular formula C26H23N3O3S2 and a molecular weight of 489.62 g/mol. Its IUPAC name is 5-[5-[5-[(3,4-dimethoxyphenyl)sulfanylamino]-3-pyridinyl]thiophen-2-yl]-2-methyl-3H-isoindol-1-one.
| Compound Name | 5-[5-[5-[(3,4-dimethoxyphenyl)sulfanylamino]-3-pyridinyl]thiophen-2-yl]-2-methyl-3H-isoindol-1-one |
|---|---|
| PubChem CID | 144576220 |
| Molecular Formula | C26H23N3O3S2 |
| Molecular Weight | 489.62 g/mol |
| Exact Mass | 489.12 |
| IUPAC Name | 5-[5-[5-[(3,4-dimethoxyphenyl)sulfanylamino]-3-pyridinyl]thiophen-2-yl]-2-methyl-3H-isoindol-1-one |
| SMILES | COc1ccc(SNc2cncc(-c3ccc(-c4ccc5c(c4)CN(C)C5=O)s3)c2)cc1OC |
| InChI | InChI=1S/C26H23N3O3S2/c1-29-15-18-10-16(4-6-21(18)26(29)30)24-8-9-25(33-24)17-11-19(14-27-13-17)28-34-20-5-7-22(31-2)23(12-20)32-3/h4-14,28H,15H2,1-3H3 |
| InChIKey | AXEYARRILQUQSF-UHFFFAOYSA-N |
| XLogP | 6.20 |
| TPSA | 63.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.62 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|